C23H27NO5 — CID 78443637
9-[3-ethoxy-4-(2-hydroxyethoxy)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 78443637) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 9-[3-ethoxy-4-(2-hydroxyethoxy)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | 9-[3-ethoxy-4-(2-hydroxyethoxy)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 78443637 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 9-[3-ethoxy-4-(2-hydroxyethoxy)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N=C3CCCC(=O)C32)ccc1OCCO |
| InChI | InChI=1S/C23H27NO5/c1-2-28-20-13-14(9-10-19(20)29-12-11-25)21-22-15(5-3-7-17(22)26)24-16-6-4-8-18(27)23(16)21/h9-10,13,21-22,25H,2-8,11-12H2,1H3 |
| InChIKey | IUANHSPUTHGLKT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |