C26H24FNO3 — CID 7381240
(9R)-9-[2-[(2-fluorophenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 7381240) has the molecular formula C26H24FNO3 and a molecular weight of 417.48 g/mol. Its IUPAC name is (9R)-9-[2-[(2-fluorophenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | (9R)-9-[2-[(2-fluorophenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 7381240 |
| Molecular Formula | C26H24FNO3 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (9R)-9-[2-[(2-fluorophenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccccc1OCc1ccccc1F)C1C(=O)CCCC1=N2 |
| InChI | InChI=1S/C26H24FNO3/c27-18-9-3-1-7-16(18)15-31-23-14-4-2-8-17(23)24-25-19(10-5-12-21(25)29)28-20-11-6-13-22(30)26(20)24/h1-4,7-9,14,24-25H,5-6,10-13,15H2/t24-,25?/m0/s1 |
| InChIKey | DRNDPQJYEKSOQH-SKCDSABHSA-N |
| XLogP | 5.32 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |