C28H29ClN2O4S — CID 1414989
(4R)-2-[(2-chlorophenyl)methylsulfanyl]-7,7-dimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 1414989) has the molecular formula C28H29ClN2O4S and a molecular weight of 525.07 g/mol. Its IUPAC name is (4R)-2-[(2-chlorophenyl)methylsulfanyl]-7,7-dimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4R)-2-[(2-chlorophenyl)methylsulfanyl]-7,7-dimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 1414989 |
| Molecular Formula | C28H29ClN2O4S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (4R)-2-[(2-chlorophenyl)methylsulfanyl]-7,7-dimethyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1cc([C@H]2C(C#N)=C(SCc3ccccc3Cl)NC3=C2C(=O)CC(C)(C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C28H29ClN2O4S/c1-28(2)12-20-25(21(32)13-28)24(17-10-22(33-3)26(35-5)23(11-17)34-4)18(14-30)27(31-20)36-15-16-8-6-7-9-19(16)29/h6-11,24,31H,12-13,15H2,1-5H3/t24-/m0/s1 |
| InChIKey | XHRWXUFOFIPPIU-DEOSSOPVSA-N |
| XLogP | 6.36 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |