C25H30FN4OS+ — CID 6985700
1-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-(4-fluorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 6985700) has the molecular formula C25H30FN4OS+ and a molecular weight of 453.61 g/mol. Its IUPAC name is 1-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-(4-fluorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-(4-fluorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 6985700 |
| Molecular Formula | C25H30FN4OS+ |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-3-(4-fluorophenyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CC[NH+]1CCC[C@@H]1CN(Cc1cc2ccc(C)cc2[nH]c1=O)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN4OS/c1-3-29-12-4-5-22(29)16-30(25(32)27-21-10-8-20(26)9-11-21)15-19-14-18-7-6-17(2)13-23(18)28-24(19)31/h6-11,13-14,22H,3-5,12,15-16H2,1-2H3,(H,27,32)(H,28,31)/p+1/t22-/m1/s1 |
| InChIKey | IAOCUTNXIRNAQJ-JOCHJYFZSA-O |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|