C21H28N3O2+ — CID 6986612
methyl 3-amino-2-[[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate (PubChem CID 6986612) has the molecular formula C21H28N3O2+ and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 3-amino-2-[[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-amino-2-[[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 6986612 |
| Molecular Formula | C21H28N3O2+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl 3-amino-2-[[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(N)c1C[NH+]1CCN(c2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C21H27N3O2/c1-15-6-4-7-16(2)20(15)24-12-10-23(11-13-24)14-18-17(21(25)26-3)8-5-9-19(18)22/h4-9H,10-14,22H2,1-3H3/p+1 |
| InChIKey | IBBWSQHOBDVPGV-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|