C13H10NO3S- — CID 6987136
3-[(4-methylbenzoyl)amino]thiophene-2-carboxylate (PubChem CID 6987136) has the molecular formula C13H10NO3S- and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[(4-methylbenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | 3-[(4-methylbenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6987136 |
| Molecular Formula | C13H10NO3S- |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-[(4-methylbenzoyl)amino]thiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)Nc2ccsc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H11NO3S/c1-8-2-4-9(5-3-8)12(15)14-10-6-7-18-11(10)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | OEGYJETWWYWHAS-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |