C12H6Cl2NO3S- — CID 7100342
3-[(2,6-dichlorobenzoyl)amino]thiophene-2-carboxylate (PubChem CID 7100342) has the molecular formula C12H6Cl2NO3S- and a molecular weight of 315.16 g/mol. Its IUPAC name is 3-[(2,6-dichlorobenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | 3-[(2,6-dichlorobenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7100342 |
| Molecular Formula | C12H6Cl2NO3S- |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 3-[(2,6-dichlorobenzoyl)amino]thiophene-2-carboxylate |
| SMILES | O=C([O-])c1sccc1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H7Cl2NO3S/c13-6-2-1-3-7(14)9(6)11(16)15-8-4-5-19-10(8)12(17)18/h1-5H,(H,15,16)(H,17,18)/p-1 |
| InChIKey | SKARHTBXRZNOFQ-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |