C10H22N4OS+2 — CID 6987895
5-(3-morpholin-4-ium-4-ylpropyl)-1,3,5-triazinan-5-ium-2-thione (PubChem CID 6987895) has the molecular formula C10H22N4OS+2 and a molecular weight of 246.38 g/mol. Its IUPAC name is 5-(3-morpholin-4-ium-4-ylpropyl)-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-(3-morpholin-4-ium-4-ylpropyl)-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 6987895 |
| Molecular Formula | C10H22N4OS+2 |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-(3-morpholin-4-ium-4-ylpropyl)-1,3,5-triazinan-5-ium-2-thione |
| SMILES | S=C1NC[NH+](CCC[NH+]2CCOCC2)CN1 |
| InChI | InChI=1S/C10H20N4OS/c16-10-11-8-14(9-12-10)3-1-2-13-4-6-15-7-5-13/h1-9H2,(H2,11,12,16)/p+2 |
| InChIKey | OKEDFZRXTVAZCU-UHFFFAOYSA-P |
| XLogP | -3.43 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|