C6H11N3O2S — CID 7016148
3-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)propanoate (PubChem CID 7016148) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)propanoate.
| Compound Name | 3-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)propanoate |
|---|---|
| PubChem CID | 7016148 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)propanoate |
| SMILES | O=C([O-])CC[NH+]1CNC(=S)NC1 |
| InChI | InChI=1S/C6H11N3O2S/c10-5(11)1-2-9-3-7-6(12)8-4-9/h1-4H2,(H,10,11)(H2,7,8,12) |
| InChIKey | OHELLDVEWGGEHW-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|