C19H12ClN2O4- — CID 6990063
5-chloro-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-2-carboxylate (PubChem CID 6990063) has the molecular formula C19H12ClN2O4- and a molecular weight of 367.77 g/mol. Its IUPAC name is 5-chloro-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-2-carboxylate.
| Compound Name | 5-chloro-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 6990063 |
| Molecular Formula | C19H12ClN2O4- |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 5-chloro-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1H-indole-2-carboxylate |
| SMILES | O=C([O-])c1[nH]c2ccc(Cl)cc2c1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13ClN2O4/c20-10-5-6-15-14(9-10)11(16(21-15)19(25)26)7-8-22-17(23)12-3-1-2-4-13(12)18(22)24/h1-6,9,21H,7-8H2,(H,25,26)/p-1 |
| InChIKey | NZNBAVDKVCPHSF-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|