C17H18ClN2O3- — CID 3293452
5-chloro-3-[2-(cyclohexylamino)-2-oxoethyl]-1H-indole-2-carboxylate (PubChem CID 3293452) has the molecular formula C17H18ClN2O3- and a molecular weight of 333.80 g/mol. Its IUPAC name is 5-chloro-3-[2-(cyclohexylamino)-2-oxoethyl]-1H-indole-2-carboxylate.
| Compound Name | 5-chloro-3-[2-(cyclohexylamino)-2-oxoethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 3293452 |
| Molecular Formula | C17H18ClN2O3- |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-chloro-3-[2-(cyclohexylamino)-2-oxoethyl]-1H-indole-2-carboxylate |
| SMILES | O=C(Cc1c(C(=O)[O-])[nH]c2ccc(Cl)cc12)NC1CCCCC1 |
| InChI | InChI=1S/C17H19ClN2O3/c18-10-6-7-14-12(8-10)13(16(20-14)17(22)23)9-15(21)19-11-4-2-1-3-5-11/h6-8,11,20H,1-5,9H2,(H,19,21)(H,22,23)/p-1 |
| InChIKey | HDXDWDJDDVCIAL-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|