C15H12FO2- — CID 6990700
2-[(3-fluoro-4-methylphenyl)methyl]benzoate (PubChem CID 6990700) has the molecular formula C15H12FO2- and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylphenyl)methyl]benzoate.
| Compound Name | 2-[(3-fluoro-4-methylphenyl)methyl]benzoate |
|---|---|
| PubChem CID | 6990700 |
| Molecular Formula | C15H12FO2- |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-[(3-fluoro-4-methylphenyl)methyl]benzoate |
| SMILES | Cc1ccc(Cc2ccccc2C(=O)[O-])cc1F |
| InChI | InChI=1S/C15H13FO2/c1-10-6-7-11(9-14(10)16)8-12-4-2-3-5-13(12)15(17)18/h2-7,9H,8H2,1H3,(H,17,18)/p-1 |
| InChIKey | NONIPMXEAJZBOX-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |