C14H18NO+ — CID 6991081
3,3-dimethyl-6-phenyl-2,5-dihydro-1H-azepin-1-ium-4-one (PubChem CID 6991081) has the molecular formula C14H18NO+ and a molecular weight of 216.30 g/mol. Its IUPAC name is 3,3-dimethyl-6-phenyl-2,5-dihydro-1H-azepin-1-ium-4-one.
| Compound Name | 3,3-dimethyl-6-phenyl-2,5-dihydro-1H-azepin-1-ium-4-one |
|---|---|
| PubChem CID | 6991081 |
| Molecular Formula | C14H18NO+ |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3,3-dimethyl-6-phenyl-2,5-dihydro-1H-azepin-1-ium-4-one |
| SMILES | CC1(C)C[NH2+]C=C(c2ccccc2)CC1=O |
| InChI | InChI=1S/C14H17NO/c1-14(2)10-15-9-12(8-13(14)16)11-6-4-3-5-7-11/h3-7,9,15H,8,10H2,1-2H3/p+1 |
| InChIKey | KEPWWVMOGLFIPK-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |