C18H16N4O3S — CID 6991494
5-methyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,3-diol (PubChem CID 6991494) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 5-methyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,3-diol.
| Compound Name | 5-methyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 6991494 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-methyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,3-diol |
| SMILES | CSc1nnc2c(n1)O[C@H](c1c(C)cc(O)cc1O)Nc1ccccc1-2 |
| InChI | InChI=1S/C18H16N4O3S/c1-9-7-10(23)8-13(24)14(9)16-19-12-6-4-3-5-11(12)15-17(25-16)20-18(26-2)22-21-15/h3-8,16,19,23-24H,1-2H3/t16-/m1/s1 |
| InChIKey | IRJBYAQXEBNMKA-MRXNPFEDSA-N |
| XLogP | 3.48 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|