C4H9N3O3 — CID 6993020
(2R)-2-azaniumyl-3-(carbamoylamino)propanoate (PubChem CID 6993020) has the molecular formula C4H9N3O3 and a molecular weight of 147.13 g/mol. Its IUPAC name is (2R)-2-azaniumyl-3-(carbamoylamino)propanoate.
| Compound Name | (2R)-2-azaniumyl-3-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 6993020 |
| Molecular Formula | C4H9N3O3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | (2R)-2-azaniumyl-3-(carbamoylamino)propanoate |
| SMILES | NC(=O)NC[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9N3O3/c5-2(3(8)9)1-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m1/s1 |
| InChIKey | GZYFIMLSHBLMKF-UWTATZPHSA-N |
| XLogP | -3.98 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |