C13H23N4O2S+ — CID 6995289
2-[(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium (PubChem CID 6995289) has the molecular formula C13H23N4O2S+ and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium.
| Compound Name | 2-[(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 6995289 |
| Molecular Formula | C13H23N4O2S+ |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)N(C)C(=S)N(C)C1=O |
| InChI | InChI=1S/C13H22N4O2S/c1-5-17(6-2)8-7-14-9-10-11(18)15(3)13(20)16(4)12(10)19/h9-10H,5-8H2,1-4H3/p+1/b14-9+ |
| InChIKey | JCDIWYDVTBQYJR-NTEUORMPSA-O |
| XLogP | -1.19 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|