C14H23N4O2S+ — CID 6997444
(5S)-5-[2-(azepan-1-ium-1-yl)ethyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 6997444) has the molecular formula C14H23N4O2S+ and a molecular weight of 311.43 g/mol. Its IUPAC name is (5S)-5-[2-(azepan-1-ium-1-yl)ethyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-5-[2-(azepan-1-ium-1-yl)ethyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 6997444 |
| Molecular Formula | C14H23N4O2S+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (5S)-5-[2-(azepan-1-ium-1-yl)ethyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)[C@@H](/C=N/CC[NH+]2CCCCCC2)C(=O)NC1=S |
| InChI | InChI=1S/C14H22N4O2S/c1-17-13(20)11(12(19)16-14(17)21)10-15-6-9-18-7-4-2-3-5-8-18/h10-11H,2-9H2,1H3,(H,16,19,21)/p+1/b15-10+/t11-/m0/s1 |
| InChIKey | VHVSRUOLQYAYKY-KBVGCWLLSA-O |
| XLogP | -0.99 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|