C15H27N5O3+2 — CID 6996805
(5R)-1-butyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6996805) has the molecular formula C15H27N5O3+2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (5R)-1-butyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-butyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6996805 |
| Molecular Formula | C15H27N5O3+2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | (5R)-1-butyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCN1C(=O)NC(=O)[C@@H](/C=N/CC[NH+]2CC[NH2+]CC2)C1=O |
| InChI | InChI=1S/C15H25N5O3/c1-2-3-7-20-14(22)12(13(21)18-15(20)23)11-17-6-10-19-8-4-16-5-9-19/h11-12,16H,2-10H2,1H3,(H,18,21,23)/p+2/b17-11+/t12-/m1/s1 |
| InChIKey | CWVQMVSAYMOXIC-PBSOMRJOSA-P |
| XLogP | -2.99 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|