C17H27N5O4 — CID 7001000
1,3-dimethyl-5-[2-[4-(2-methylpropanoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7001000) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-[4-(2-methylpropanoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[2-[4-(2-methylpropanoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7001000 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1,3-dimethyl-5-[2-[4-(2-methylpropanoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C(=O)N1CCN(CC/N=C/C2C(=O)N(C)C(=O)N(C)C2=O)CC1 |
| InChI | InChI=1S/C17H27N5O4/c1-12(2)14(23)22-9-7-21(8-10-22)6-5-18-11-13-15(24)19(3)17(26)20(4)16(13)25/h11-13H,5-10H2,1-4H3/b18-11+ |
| InChIKey | REWVQWGNGGVTKE-WOJGMQOQSA-N |
| XLogP | -0.48 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|