C11H17N5O3 — CID 7102658
5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7102658) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7102658 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/CCN2CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C11H17N5O3/c17-9-8(10(18)15-11(19)14-9)7-13-3-6-16-4-1-12-2-5-16/h7-8,12H,1-6H2,(H2,14,15,17,18,19)/b13-7+ |
| InChIKey | CGFPNDRRVZIIEZ-NTUHNPAUSA-N |
| XLogP | -2.06 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|