C14H23N6O3S+ — CID 6998197
N-ethyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide (PubChem CID 6998197) has the molecular formula C14H23N6O3S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is N-ethyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-ethyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 6998197 |
| Molecular Formula | C14H23N6O3S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-ethyl-4-[2-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl]piperazin-4-ium-1-carbothioamide |
| SMILES | CCNC(=S)N1CC[NH+](CC/N=C/C2C(=O)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C14H22N6O3S/c1-2-16-14(24)20-7-5-19(6-8-20)4-3-15-9-10-11(21)17-13(23)18-12(10)22/h9-10H,2-8H2,1H3,(H,16,24)(H2,17,18,21,22,23)/p+1/b15-9+ |
| InChIKey | WKTIUDNYRBGKNP-OQLLNIDSSA-O |
| XLogP | -2.87 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|