C11H20N5O3+3 — CID 7102657
2-piperazine-1,4-diium-1-ylethyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium (PubChem CID 7102657) has the molecular formula C11H20N5O3+3 and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-piperazine-1,4-diium-1-ylethyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium.
| Compound Name | 2-piperazine-1,4-diium-1-ylethyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 7102657 |
| Molecular Formula | C11H20N5O3+3 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-piperazine-1,4-diium-1-ylethyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
| SMILES | O=C1NC(=O)C(/C=[NH+]/CC[NH+]2CC[NH2+]CC2)C(=O)N1 |
| InChI | InChI=1S/C11H17N5O3/c17-9-8(10(18)15-11(19)14-9)7-13-3-6-16-4-1-12-2-5-16/h7-8,12H,1-6H2,(H2,14,15,17,18,19)/p+3/b13-7+ |
| InChIKey | CGFPNDRRVZIIEZ-NTUHNPAUSA-Q |
| XLogP | -6.42 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|