C15H13F3N2O2S — CID 6998060
N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide (PubChem CID 6998060) has the molecular formula C15H13F3N2O2S and a molecular weight of 342.34 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide.
| Compound Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide |
|---|---|
| PubChem CID | 6998060 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-methyl-N-phenylethanimidamide |
| SMILES | CN(C(=NS(=O)(=O)c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O2S/c1-20(12-8-4-2-5-9-12)14(15(16,17)18)19-23(21,22)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | QXSIAMYYYLVOPV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|