C26H28N4O10S — CID 70000190
oxalic acid;N-[2-[4-(13-thia-4,7-diazatricyclo[8.3.0.03,7]trideca-1(10),3,5,11-tetraen-2-ylidene)piperidin-1-yl]ethyl]furan-3-carboxamide (PubChem CID 70000190) has the molecular formula C26H28N4O10S and a molecular weight of 588.60 g/mol. Its IUPAC name is oxalic acid;N-[2-[4-(13-thia-4,7-diazatricyclo[8.3.0.03,7]trideca-1(10),3,5,11-tetraen-2-ylidene)piperidin-1-yl]ethyl]furan-3-carboxamide.
| Compound Name | oxalic acid;N-[2-[4-(13-thia-4,7-diazatricyclo[8.3.0.03,7]trideca-1(10),3,5,11-tetraen-2-ylidene)piperidin-1-yl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 70000190 |
| Molecular Formula | C26H28N4O10S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | oxalic acid;N-[2-[4-(13-thia-4,7-diazatricyclo[8.3.0.03,7]trideca-1(10),3,5,11-tetraen-2-ylidene)piperidin-1-yl]ethyl]furan-3-carboxamide |
| SMILES | O=C(NCCN1CCC(=C2c3sccc3CCn3ccnc32)CC1)c1ccoc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H24N4O2S.2C2H2O4/c27-22(18-4-13-28-15-18)24-6-11-25-8-1-16(2-9-25)19-20-17(5-14-29-20)3-10-26-12-7-23-21(19)26;2*3-1(4)2(5)6/h4-5,7,12-15H,1-3,6,8-11H2,(H,24,27);2*(H,3,4)(H,5,6) |
| InChIKey | UUQIPNVVRJVGBW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 212.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|