C23H26N6O — CID 19371588
2-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethylamino]-1H-pyrimidin-6-one (PubChem CID 19371588) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 19371588 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(NCCN2CCC(=C3c4ccccc4CCn4ccnc43)CC2)[nH]1 |
| InChI | InChI=1S/C23H26N6O/c30-20-5-9-25-23(27-20)26-10-15-28-12-6-18(7-13-28)21-19-4-2-1-3-17(19)8-14-29-16-11-24-22(21)29/h1-5,9,11,16H,6-8,10,12-15H2,(H2,25,26,27,30) |
| InChIKey | QFFXEJRJHWMXLQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|