C24H28FN3O6 — CID 70001767
tert-butyl N-[5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-(4-fluorophenyl)-2-nitrophenyl]carbamate (PubChem CID 70001767) has the molecular formula C24H28FN3O6 and a molecular weight of 473.50 g/mol. Its IUPAC name is tert-butyl N-[5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-(4-fluorophenyl)-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-(4-fluorophenyl)-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 70001767 |
| Molecular Formula | C24H28FN3O6 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | tert-butyl N-[5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-(4-fluorophenyl)-2-nitrophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N2CCC3(CC2)OCCO3)c(-c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28FN3O6/c1-23(2,3)34-22(29)26-19-15-20(27-10-8-24(9-11-27)32-12-13-33-24)18(14-21(19)28(30)31)16-4-6-17(25)7-5-16/h4-7,14-15H,8-13H2,1-3H3,(H,26,29) |
| InChIKey | BVQPNXUZFDWHSU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|