C24H32ClN5O4S — CID 70002109
(2S)-1-[(4-carbamimidoylphenyl)methyl]-N-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 70002109) has the molecular formula C24H32ClN5O4S and a molecular weight of 522.07 g/mol. Its IUPAC name is (2S)-1-[(4-carbamimidoylphenyl)methyl]-N-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-1-[(4-carbamimidoylphenyl)methyl]-N-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70002109 |
| Molecular Formula | C24H32ClN5O4S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (2S)-1-[(4-carbamimidoylphenyl)methyl]-N-[(2R)-2-(ethylsulfonylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CN2CCC[C@H]2C(=O)NC(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C24H31N5O4S.ClH/c1-2-34(32,33)28-20(15-17-7-4-3-5-8-17)23(30)27-24(31)21-9-6-14-29(21)16-18-10-12-19(13-11-18)22(25)26;/h3-5,7-8,10-13,20-21,28H,2,6,9,14-16H2,1H3,(H3,25,26)(H,27,30,31);1H/t20-,21+;/m1./s1 |
| InChIKey | QXCUTCZHJKFNBF-BHDTVMLSSA-N |
| XLogP | 1.55 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|