C16H18O6 — CID 70005441
(1R,3R,7S,9R)-5-ethyl-11-phenyl-2,4,6,10,12-pentaoxatricyclo[7.4.0.03,7]tridecan-8-one (PubChem CID 70005441) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is (1R,3R,7S,9R)-5-ethyl-11-phenyl-2,4,6,10,12-pentaoxatricyclo[7.4.0.03,7]tridecan-8-one.
| Compound Name | (1R,3R,7S,9R)-5-ethyl-11-phenyl-2,4,6,10,12-pentaoxatricyclo[7.4.0.03,7]tridecan-8-one |
|---|---|
| PubChem CID | 70005441 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (1R,3R,7S,9R)-5-ethyl-11-phenyl-2,4,6,10,12-pentaoxatricyclo[7.4.0.03,7]tridecan-8-one |
| SMILES | CCC1O[C@H]2O[C@@H]3COC(c4ccccc4)O[C@H]3C(=O)[C@H]2O1 |
| InChI | InChI=1S/C16H18O6/c1-2-11-20-14-12(17)13-10(19-16(14)21-11)8-18-15(22-13)9-6-4-3-5-7-9/h3-7,10-11,13-16H,2,8H2,1H3/t10-,11?,13-,14-,15?,16-/m1/s1 |
| InChIKey | ZKAMURVMIFUREV-UFJXHFMDSA-N |
| XLogP | 1.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |