C23H28O3 — CID 142857405
(9S)-9-ethyl-7-methyl-2,6-diphenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepine (PubChem CID 142857405) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (9S)-9-ethyl-7-methyl-2,6-diphenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepine.
| Compound Name | (9S)-9-ethyl-7-methyl-2,6-diphenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepine |
|---|---|
| PubChem CID | 142857405 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (9S)-9-ethyl-7-methyl-2,6-diphenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepine |
| SMILES | CC[C@H]1CC(C)C(c2ccccc2)OC2COC(c3ccccc3)OC21 |
| InChI | InChI=1S/C23H28O3/c1-3-17-14-16(2)21(18-10-6-4-7-11-18)25-20-15-24-23(26-22(17)20)19-12-8-5-9-13-19/h4-13,16-17,20-23H,3,14-15H2,1-2H3/t16?,17-,20?,21?,22?,23?/m0/s1 |
| InChIKey | GEKKFYXJARDBRN-QBOUSDEDSA-N |
| XLogP | 5.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |