C26H24N2O5 — CID 70005691
benzene-1,4-diamine;7-O-benzyl 2-O-methyl 3-hydroxynaphthalene-2,7-dicarboxylate (PubChem CID 70005691) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is benzene-1,4-diamine;7-O-benzyl 2-O-methyl 3-hydroxynaphthalene-2,7-dicarboxylate.
| Compound Name | benzene-1,4-diamine;7-O-benzyl 2-O-methyl 3-hydroxynaphthalene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 70005691 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | benzene-1,4-diamine;7-O-benzyl 2-O-methyl 3-hydroxynaphthalene-2,7-dicarboxylate |
| SMILES | COC(=O)c1cc2cc(C(=O)OCc3ccccc3)ccc2cc1O.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C20H16O5.C6H8N2/c1-24-20(23)17-10-16-9-15(8-7-14(16)11-18(17)21)19(22)25-12-13-5-3-2-4-6-13;7-5-1-2-6(8)4-3-5/h2-11,21H,12H2,1H3;1-4H,7-8H2 |
| InChIKey | CTQOXRMJLHCYCG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|