C27H23FN2O5 — CID 70009114
(4-nitrophenyl) 9-[(4-fluorophenyl)methyl]-1-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate (PubChem CID 70009114) has the molecular formula C27H23FN2O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is (4-nitrophenyl) 9-[(4-fluorophenyl)methyl]-1-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate.
| Compound Name | (4-nitrophenyl) 9-[(4-fluorophenyl)methyl]-1-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate |
|---|---|
| PubChem CID | 70009114 |
| Molecular Formula | C27H23FN2O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (4-nitrophenyl) 9-[(4-fluorophenyl)methyl]-1-methoxy-5,6,7,8-tetrahydrocarbazole-4-carboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc([N+](=O)[O-])cc2)c2c3c(n(Cc4ccc(F)cc4)c12)CCCC3 |
| InChI | InChI=1S/C27H23FN2O5/c1-34-24-15-14-22(27(31)35-20-12-10-19(11-13-20)30(32)33)25-21-4-2-3-5-23(21)29(26(24)25)16-17-6-8-18(28)9-7-17/h6-15H,2-5,16H2,1H3 |
| InChIKey | PJPKWKBHQWJVDT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|