C22H17NO8 — CID 175092673
2,4-dimethoxy-3-[4-(4-nitrophenoxy)carbonylphenyl]benzoic acid (PubChem CID 175092673) has the molecular formula C22H17NO8 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2,4-dimethoxy-3-[4-(4-nitrophenoxy)carbonylphenyl]benzoic acid.
| Compound Name | 2,4-dimethoxy-3-[4-(4-nitrophenoxy)carbonylphenyl]benzoic acid |
|---|---|
| PubChem CID | 175092673 |
| Molecular Formula | C22H17NO8 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2,4-dimethoxy-3-[4-(4-nitrophenoxy)carbonylphenyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)c(OC)c1-c1ccc(C(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H17NO8/c1-29-18-12-11-17(21(24)25)20(30-2)19(18)13-3-5-14(6-4-13)22(26)31-16-9-7-15(8-10-16)23(27)28/h3-12H,1-2H3,(H,24,25) |
| InChIKey | ILCYITOGLYQTRW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|