C15H23F3N2O — CID 70009287
1-(4,5-dipentyl-1H-imidazol-2-yl)-2,2,2-trifluoroethanone (PubChem CID 70009287) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-(4,5-dipentyl-1H-imidazol-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4,5-dipentyl-1H-imidazol-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 70009287 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(4,5-dipentyl-1H-imidazol-2-yl)-2,2,2-trifluoroethanone |
| SMILES | CCCCCc1nc(C(=O)C(F)(F)F)[nH]c1CCCCC |
| InChI | InChI=1S/C15H23F3N2O/c1-3-5-7-9-11-12(10-8-6-4-2)20-14(19-11)13(21)15(16,17)18/h3-10H2,1-2H3,(H,19,20) |
| InChIKey | PRZILVQELJGAHC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|