C32H43N5O4 — CID 70013854
tert-butyl N-[(2R)-1-[2-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidin-1-yl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 70013854) has the molecular formula C32H43N5O4 and a molecular weight of 561.73 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidin-1-yl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidin-1-yl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70013854 |
| Molecular Formula | C32H43N5O4 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidin-1-yl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CN(C)N(C)C(=O)C1CCCN(C(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)OC(C)(C)C)C1Cc1ccccc1 |
| InChI | InChI=1S/C32H43N5O4/c1-32(2,3)41-31(40)34-27(20-23-21-33-26-17-11-10-15-24(23)26)30(39)37-18-12-16-25(29(38)36(6)35(4)5)28(37)19-22-13-8-7-9-14-22/h7-11,13-15,17,21,25,27-28,33H,12,16,18-20H2,1-6H3,(H,34,40)/t25?,27-,28?/m1/s1 |
| InChIKey | ZZRVMTCNUHTHQD-YVVHSEAESA-N |
| XLogP | 4.39 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|