C16H16ClN3O3 — CID 70016294
2-chloro-N-[4-[3-oxo-3-(7-oxo-2,6-diazabicyclo[3.2.0]heptan-2-yl)prop-1-enyl]phenyl]acetamide (PubChem CID 70016294) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 2-chloro-N-[4-[3-oxo-3-(7-oxo-2,6-diazabicyclo[3.2.0]heptan-2-yl)prop-1-enyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[3-oxo-3-(7-oxo-2,6-diazabicyclo[3.2.0]heptan-2-yl)prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 70016294 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-N-[4-[3-oxo-3-(7-oxo-2,6-diazabicyclo[3.2.0]heptan-2-yl)prop-1-enyl]phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(C=CC(=O)N2CCC3NC(=O)C32)cc1 |
| InChI | InChI=1S/C16H16ClN3O3/c17-9-13(21)18-11-4-1-10(2-5-11)3-6-14(22)20-8-7-12-15(20)16(23)19-12/h1-6,12,15H,7-9H2,(H,18,21)(H,19,23) |
| InChIKey | CPZNVGLEWXGORW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|