C29H27FO5 — CID 70017051
ethyl 3-[4-[2-(3-fluoro-4-methoxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoate (PubChem CID 70017051) has the molecular formula C29H27FO5 and a molecular weight of 474.53 g/mol. Its IUPAC name is ethyl 3-[4-[2-(3-fluoro-4-methoxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoate.
| Compound Name | ethyl 3-[4-[2-(3-fluoro-4-methoxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoate |
|---|---|
| PubChem CID | 70017051 |
| Molecular Formula | C29H27FO5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | ethyl 3-[4-[2-(3-fluoro-4-methoxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Oc2c(-c3ccc(OC)c(F)c3)ccc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C29H27FO5/c1-4-34-28(31)16-7-19-5-10-22(11-6-19)35-29-24(21-9-15-27(33-3)26(30)18-21)13-8-20-17-23(32-2)12-14-25(20)29/h5-6,8-15,17-18H,4,7,16H2,1-3H3 |
| InChIKey | BRHUKFHFJAEVQL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |