C30H30O4 — CID 70018001
butyl 3-[4-[2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]propanoate (PubChem CID 70018001) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is butyl 3-[4-[2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]propanoate.
| Compound Name | butyl 3-[4-[2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]propanoate |
|---|---|
| PubChem CID | 70018001 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | butyl 3-[4-[2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]propanoate |
| SMILES | CCCCOC(=O)CCc1ccc(Oc2c(-c3ccc(OC)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H30O4/c1-3-4-21-33-29(31)20-11-22-9-15-26(16-10-22)34-30-27-8-6-5-7-23(27)14-19-28(30)24-12-17-25(32-2)18-13-24/h5-10,12-19H,3-4,11,20-21H2,1-2H3 |
| InChIKey | MZVADGPPEXOMQO-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|