C8H10FNO6 — CID 70023812
[(1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluoro-6-bicyclo[3.1.0]hexanyl] hydrogen carbonate (PubChem CID 70023812) has the molecular formula C8H10FNO6 and a molecular weight of 235.17 g/mol. Its IUPAC name is [(1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluoro-6-bicyclo[3.1.0]hexanyl] hydrogen carbonate.
| Compound Name | [(1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluoro-6-bicyclo[3.1.0]hexanyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70023812 |
| Molecular Formula | C8H10FNO6 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | [(1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluoro-6-bicyclo[3.1.0]hexanyl] hydrogen carbonate |
| SMILES | N[C@]1(OC(=O)O)[C@H]2[C@@H](C[C@@H]1F)[C@@H]2OC(=O)O |
| InChI | InChI=1S/C8H10FNO6/c9-3-1-2-4(5(2)15-6(11)12)8(3,10)16-7(13)14/h2-5H,1,10H2,(H,11,12)(H,13,14)/t2-,3+,4+,5+,8-/m1/s1 |
| InChIKey | ZWORYBRDTAMWAR-POLWSVIISA-N |
| XLogP | 0.39 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|