C13H14FNO8 — CID 130273525
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 130273525) has the molecular formula C13H14FNO8 and a molecular weight of 331.25 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 130273525 |
| Molecular Formula | C13H14FNO8 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | Cc1oc(=O)oc1COC(=O)[C@H]1[C@@H]2C[C@H](F)[C@@](N)(OC(=O)O)[C@@H]21 |
| InChI | InChI=1S/C13H14FNO8/c1-4-6(22-12(19)21-4)3-20-10(16)8-5-2-7(14)13(15,9(5)8)23-11(17)18/h5,7-9H,2-3,15H2,1H3,(H,17,18)/t5-,7-,8-,9-,13+/m0/s1 |
| InChIKey | LJJZRLAXOXPZIM-TYRYUSMXSA-N |
| XLogP | 0.54 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|