C19H28FNO8 — CID 130272793
1-(4,4-dimethylcyclohexyl)oxycarbonyloxyethyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 130272793) has the molecular formula C19H28FNO8 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)oxycarbonyloxyethyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | 1-(4,4-dimethylcyclohexyl)oxycarbonyloxyethyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 130272793 |
| Molecular Formula | C19H28FNO8 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)oxycarbonyloxyethyl (1S,2S,3S,5R,6S)-2-amino-2-carboxyoxy-3-fluorobicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CC(OC(=O)OC1CCC(C)(C)CC1)OC(=O)[C@H]1[C@@H]2C[C@H](F)[C@@](N)(OC(=O)O)[C@@H]21 |
| InChI | InChI=1S/C19H28FNO8/c1-9(27-17(25)28-10-4-6-18(2,3)7-5-10)26-15(22)13-11-8-12(20)19(21,14(11)13)29-16(23)24/h9-14H,4-8,21H2,1-3H3,(H,23,24)/t9?,11-,12-,13-,14-,19+/m0/s1 |
| InChIKey | FAALHCGVLCYWOQ-LGYLOAHCSA-N |
| XLogP | 2.95 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|