C16H22O8 — CID 70024043
1-[2-hydroxy-4-methoxy-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]ethanone (PubChem CID 70024043) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is 1-[2-hydroxy-4-methoxy-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[2-hydroxy-4-methoxy-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 70024043 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[2-hydroxy-4-methoxy-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]ethanone |
| SMILES | COc1cc(O)c(C(C)=O)c(C[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C16H22O8/c1-7(18)13-8(3-9(23-2)5-10(13)19)4-11-14(20)16(22)15(21)12(6-17)24-11/h3,5,11-12,14-17,19-22H,4,6H2,1-2H3/t11-,12+,14-,15+,16+/m0/s1 |
| InChIKey | CKCNCIDOGXUSMP-FHXAZYNBSA-N |
| XLogP | -1.01 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |