C23H23N4O6+ — CID 70024052
4-[1-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 70024052) has the molecular formula C23H23N4O6+ and a molecular weight of 451.46 g/mol. Its IUPAC name is 4-[1-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[1-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 70024052 |
| Molecular Formula | C23H23N4O6+ |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-[1-(4-cyanophenyl)-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC1NC(=O)[N+](CCC(NC(=O)OCc2ccccc2)C(=O)O)(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C23H22N4O6/c1-15-20(28)27(22(31)25-15,18-9-7-16(13-24)8-10-18)12-11-19(21(29)30)26-23(32)33-14-17-5-3-2-4-6-17/h2-10,15,19H,11-12,14H2,1H3,(H2-,25,26,29,30,31,32)/p+1 |
| InChIKey | AHKMSQKTAZKYAQ-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|