C37H37N6O6+ — CID 70024337
benzyl 4-[1-[4-[(1H-benzimidazol-2-ylamino)methyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 70024337) has the molecular formula C37H37N6O6+ and a molecular weight of 661.74 g/mol. Its IUPAC name is benzyl 4-[1-[4-[(1H-benzimidazol-2-ylamino)methyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | benzyl 4-[1-[4-[(1H-benzimidazol-2-ylamino)methyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 70024337 |
| Molecular Formula | C37H37N6O6+ |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | benzyl 4-[1-[4-[(1H-benzimidazol-2-ylamino)methyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-ium-1-yl]-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC1NC(=O)[N+](CCC(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)(c2ccc(CNc3nc4ccccc4[nH]3)cc2)C1=O |
| InChI | InChI=1S/C37H36N6O6/c1-25-33(44)43(36(46)39-25,29-18-16-26(17-19-29)22-38-35-40-30-14-8-9-15-31(30)41-35)21-20-32(34(45)48-23-27-10-4-2-5-11-27)42-37(47)49-24-28-12-6-3-7-13-28/h2-19,25,32H,20-24H2,1H3,(H3-,38,39,40,41,42,46,47)/p+1 |
| InChIKey | KMAJQKSMNROTKX-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|