C27H31N7O7 — CID 22993657
3-[[2-[4-[3-(1H-benzimidazol-2-ylamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 22993657) has the molecular formula C27H31N7O7 and a molecular weight of 565.59 g/mol. Its IUPAC name is 3-[[2-[4-[3-(1H-benzimidazol-2-ylamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[2-[4-[3-(1H-benzimidazol-2-ylamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 22993657 |
| Molecular Formula | C27H31N7O7 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 3-[[2-[4-[3-(1H-benzimidazol-2-ylamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CN1C(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C(=O)C1CCCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H31N7O7/c1-33-21(12-7-13-28-25-30-18-10-5-6-11-19(18)31-25)23(36)34(27(33)40)15-22(35)29-14-20(24(37)38)32-26(39)41-16-17-8-3-2-4-9-17/h2-6,8-11,20-21H,7,12-16H2,1H3,(H,29,35)(H,32,39)(H,37,38)(H2,28,30,31) |
| InChIKey | BJOFQEVNEMAKLF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|