C28H33NO3 — CID 70024912
3-[3-[benzyl(1-phenylethyl)amino]-4-tert-butyl-2-hydroxyphenyl]propanoic acid (PubChem CID 70024912) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-[3-[benzyl(1-phenylethyl)amino]-4-tert-butyl-2-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[benzyl(1-phenylethyl)amino]-4-tert-butyl-2-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 70024912 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-[3-[benzyl(1-phenylethyl)amino]-4-tert-butyl-2-hydroxyphenyl]propanoic acid |
| SMILES | CC(c1ccccc1)N(Cc1ccccc1)c1c(C(C)(C)C)ccc(CCC(=O)O)c1O |
| InChI | InChI=1S/C28H33NO3/c1-20(22-13-9-6-10-14-22)29(19-21-11-7-5-8-12-21)26-24(28(2,3)4)17-15-23(27(26)32)16-18-25(30)31/h5-15,17,20,32H,16,18-19H2,1-4H3,(H,30,31) |
| InChIKey | UGJPXLUUKDJCCL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |