C25H19N3O3 — CID 70025907
2-[4-[2-(3-cyano-1H-indol-5-yl)ethylcarbamoyl]phenyl]benzoic acid (PubChem CID 70025907) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-[4-[2-(3-cyano-1H-indol-5-yl)ethylcarbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[2-(3-cyano-1H-indol-5-yl)ethylcarbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70025907 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[4-[2-(3-cyano-1H-indol-5-yl)ethylcarbamoyl]phenyl]benzoic acid |
| SMILES | N#Cc1c[nH]c2ccc(CCNC(=O)c3ccc(-c4ccccc4C(=O)O)cc3)cc12 |
| InChI | InChI=1S/C25H19N3O3/c26-14-19-15-28-23-10-5-16(13-22(19)23)11-12-27-24(29)18-8-6-17(7-9-18)20-3-1-2-4-21(20)25(30)31/h1-10,13,15,28H,11-12H2,(H,27,29)(H,30,31) |
| InChIKey | FXECELBQRWRCMP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |