C32H37N7O — CID 18617736
N-[2-(3-cyano-1H-indol-5-yl)ethyl]-4-[2-(6-pyrrolidin-1-ylhexylamino)pyrimidin-4-yl]benzamide (PubChem CID 18617736) has the molecular formula C32H37N7O and a molecular weight of 535.70 g/mol. Its IUPAC name is N-[2-(3-cyano-1H-indol-5-yl)ethyl]-4-[2-(6-pyrrolidin-1-ylhexylamino)pyrimidin-4-yl]benzamide.
| Compound Name | N-[2-(3-cyano-1H-indol-5-yl)ethyl]-4-[2-(6-pyrrolidin-1-ylhexylamino)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 18617736 |
| Molecular Formula | C32H37N7O |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | N-[2-(3-cyano-1H-indol-5-yl)ethyl]-4-[2-(6-pyrrolidin-1-ylhexylamino)pyrimidin-4-yl]benzamide |
| SMILES | N#Cc1c[nH]c2ccc(CCNC(=O)c3ccc(-c4ccnc(NCCCCCCN5CCCC5)n4)cc3)cc12 |
| InChI | InChI=1S/C32H37N7O/c33-22-27-23-37-30-12-7-24(21-28(27)30)13-16-34-31(40)26-10-8-25(9-11-26)29-14-17-36-32(38-29)35-15-3-1-2-4-18-39-19-5-6-20-39/h7-12,14,17,21,23,37H,1-6,13,15-16,18-20H2,(H,34,40)(H,35,36,38) |
| InChIKey | JHCMVARSCKNTSJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|