C20H20F2N2O7S2 — CID 70026053
3-[1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-8-yl]-1,1-bis(methylsulfonyl)urea (PubChem CID 70026053) has the molecular formula C20H20F2N2O7S2 and a molecular weight of 502.52 g/mol. Its IUPAC name is 3-[1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-8-yl]-1,1-bis(methylsulfonyl)urea.
| Compound Name | 3-[1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-8-yl]-1,1-bis(methylsulfonyl)urea |
|---|---|
| PubChem CID | 70026053 |
| Molecular Formula | C20H20F2N2O7S2 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-[1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-8-yl]-1,1-bis(methylsulfonyl)urea |
| SMILES | C=CCC1Oc2cccc(OC(F)F)c2-c2ccc(NC(=O)N(S(C)(=O)=O)S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C20H20F2N2O7S2/c1-4-6-15-14-11-12(23-20(25)24(32(2,26)27)33(3,28)29)9-10-13(14)18-16(30-15)7-5-8-17(18)31-19(21)22/h4-5,7-11,15,19H,1,6H2,2-3H3,(H,23,25) |
| InChIKey | SEQPYGYOYNCDKZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|