C18H16BrF2NO4S — CID 18189249
[3-bromo-1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-9-yl]methanesulfonamide (PubChem CID 18189249) has the molecular formula C18H16BrF2NO4S and a molecular weight of 460.30 g/mol. Its IUPAC name is [3-bromo-1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-9-yl]methanesulfonamide.
| Compound Name | [3-bromo-1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-9-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18189249 |
| Molecular Formula | C18H16BrF2NO4S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | [3-bromo-1-(difluoromethoxy)-6-prop-2-enyl-6H-benzo[c]chromen-9-yl]methanesulfonamide |
| SMILES | C=CCC1Oc2cc(Br)cc(OC(F)F)c2-c2cc(CS(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H16BrF2NO4S/c1-2-3-14-12-5-4-10(9-27(22,23)24)6-13(12)17-15(25-14)7-11(19)8-16(17)26-18(20)21/h2,4-8,14,18H,1,3,9H2,(H2,22,23,24) |
| InChIKey | IWEBEJQRZABFFJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|