C23H27NO5S — CID 70026257
[6-(4-but-3-enoxybut-2-enyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 70026257) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is [6-(4-but-3-enoxybut-2-enyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [6-(4-but-3-enoxybut-2-enyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 70026257 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [6-(4-but-3-enoxybut-2-enyl)-1-methoxy-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | C=CCCOCC=CCC1Oc2cccc(OC)c2-c2ccc(CS(N)(=O)=O)cc21 |
| InChI | InChI=1S/C23H27NO5S/c1-3-4-13-28-14-6-5-8-20-19-15-17(16-30(24,25)26)11-12-18(19)23-21(27-2)9-7-10-22(23)29-20/h3,5-7,9-12,15,20H,1,4,8,13-14,16H2,2H3,(H2,24,25,26) |
| InChIKey | NTEAFVVALMIMGW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|